C13H21N3O — CID 77038150
N'-hydroxy-2-[2-phenylethyl(propan-2-yl)amino]ethanimidamide (PubChem CID 77038150) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is N'-hydroxy-2-[2-phenylethyl(propan-2-yl)amino]ethanimidamide.
| Compound Name | N'-hydroxy-2-[2-phenylethyl(propan-2-yl)amino]ethanimidamide |
|---|---|
| PubChem CID | 77038150 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | N'-hydroxy-2-[2-phenylethyl(propan-2-yl)amino]ethanimidamide |
| SMILES | CC(C)N(CCc1ccccc1)CC(N)=NO |
| InChI | InChI=1S/C13H21N3O/c1-11(2)16(10-13(14)15-17)9-8-12-6-4-3-5-7-12/h3-7,11,17H,8-10H2,1-2H3,(H2,14,15) |
| InChIKey | LLJPYKXUSQETCP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|