C11H16N2 — CID 43175779
2-propyl-1,3-dihydroisoindol-5-amine (PubChem CID 43175779) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-propyl-1,3-dihydroisoindol-5-amine.
| Compound Name | 2-propyl-1,3-dihydroisoindol-5-amine |
|---|---|
| PubChem CID | 43175779 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-propyl-1,3-dihydroisoindol-5-amine |
| SMILES | CCCN1Cc2ccc(N)cc2C1 |
| InChI | InChI=1S/C11H16N2/c1-2-5-13-7-9-3-4-11(12)6-10(9)8-13/h3-4,6H,2,5,7-8,12H2,1H3 |
| InChIKey | OTVMJIZBIJQTPX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|