C12H20N2 — CID 3043606
4-(2-aminopropyl)-N,N,3-trimethylaniline (PubChem CID 3043606) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 4-(2-aminopropyl)-N,N,3-trimethylaniline.
| Compound Name | 4-(2-aminopropyl)-N,N,3-trimethylaniline |
|---|---|
| PubChem CID | 3043606 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 4-(2-aminopropyl)-N,N,3-trimethylaniline |
| SMILES | Cc1cc(N(C)C)ccc1CC(C)N |
| InChI | InChI=1S/C12H20N2/c1-9-7-12(14(3)4)6-5-11(9)8-10(2)13/h5-7,10H,8,13H2,1-4H3 |
| InChIKey | HFQMYSHATTXRTC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|