About 4-(2-aminopropyl)-N,N,3-trimethylaniline
4-(2-aminopropyl)-N,N,3-trimethylaniline (PubChem CID 3043606) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 4-(2-aminopropyl)-N,N,3-trimethylaniline.
Molecular Properties
| Compound Name | 4-(2-aminopropyl)-N,N,3-trimethylaniline |
| PubChem CID | 3043606 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 4-(2-aminopropyl)-N,N,3-trimethylaniline |
| SMILES | Cc1cc(N(C)C)ccc1CC(C)N |
| InChI | InChI=1S/C12H20N2/c1-9-7-12(14(3)4)6-5-11(9)8-10(2)13/h5-7,10H,8,13H2,1-4H3 |
| InChIKey | HFQMYSHATTXRTC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-aminopropyl)-N,N,3-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminopropyl)-N,N,3-trimethylaniline?
The IUPAC name of 4-(2-aminopropyl)-N,N,3-trimethylaniline (CID 3043606) is 4-(2-aminopropyl)-N,N,3-trimethylaniline.
What is the SMILES notation for 4-(2-aminopropyl)-N,N,3-trimethylaniline?
The canonical SMILES for 4-(2-aminopropyl)-N,N,3-trimethylaniline is Cc1cc(N(C)C)ccc1CC(C)N.
What is the InChIKey of 4-(2-aminopropyl)-N,N,3-trimethylaniline?
The InChIKey is HFQMYSHATTXRTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-9-7-12(14(3)4)6-5-11(9)8-10(2)13/h5-7,10H,8,13H2,1-4H3.
What are the key properties of 4-(2-aminopropyl)-N,N,3-trimethylaniline?
4-(2-aminopropyl)-N,N,3-trimethylaniline has a molecular weight of 192.31 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminopropyl)-N,N,3-trimethylaniline is sourced from PubChem (CID 3043606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).