C12H18BrN — CID 43177710
N-[(3-bromophenyl)methyl]pentan-2-amine (PubChem CID 43177710) has the molecular formula C12H18BrN and a molecular weight of 256.19 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]pentan-2-amine.
| Compound Name | N-[(3-bromophenyl)methyl]pentan-2-amine |
|---|---|
| PubChem CID | 43177710 |
| Molecular Formula | C12H18BrN |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | N-[(3-bromophenyl)methyl]pentan-2-amine |
| SMILES | CCCC(C)NCc1cccc(Br)c1 |
| InChI | InChI=1S/C12H18BrN/c1-3-5-10(2)14-9-11-6-4-7-12(13)8-11/h4,6-8,10,14H,3,5,9H2,1-2H3 |
| InChIKey | VHFJNBFPZRMINB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |