C12H18F5NS — CID 170384359
N-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methyl]pentan-2-amine (PubChem CID 170384359) has the molecular formula C12H18F5NS and a molecular weight of 303.34 g/mol. Its IUPAC name is N-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methyl]pentan-2-amine.
| Compound Name | N-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methyl]pentan-2-amine |
|---|---|
| PubChem CID | 170384359 |
| Molecular Formula | C12H18F5NS |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methyl]pentan-2-amine |
| SMILES | CCCC(C)NCc1cccc(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C12H18F5NS/c1-3-5-10(2)18-9-11-6-4-7-12(8-11)19(13,14,15,16)17/h4,6-8,10,18H,3,5,9H2,1-2H3 |
| InChIKey | XRURGHOLRPFJOD-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |