About 1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-amine
1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-amine (PubChem CID 23643874) has the molecular formula C9H12F5NS
and a molecular weight of 261.26 g/mol. Its IUPAC name is 1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-amine.
Molecular Properties
| Compound Name | 1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-amine |
| PubChem CID | 23643874 |
| Molecular Formula | C9H12F5NS |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-amine |
| SMILES | CC(N)Cc1cccc(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C9H12F5NS/c1-7(15)5-8-3-2-4-9(6-8)16(10,11,12,13)14/h2-4,6-7H,5,15H2,1H3 |
| InChIKey | YGBSUVPUXAMOTQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-amine?
The IUPAC name of 1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-amine (CID 23643874) is 1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-amine.
What is the SMILES notation for 1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-amine?
The canonical SMILES for 1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-amine is CC(N)Cc1cccc(S(F)(F)(F)(F)F)c1.
What is the InChIKey of 1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-amine?
The InChIKey is YGBSUVPUXAMOTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F5NS/c1-7(15)5-8-3-2-4-9(6-8)16(10,11,12,13)14/h2-4,6-7H,5,15H2,1H3.
What are the key properties of 1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-amine?
1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-amine has a molecular weight of 261.26 g/mol, XLogP of 4.23, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(pentafluoro-λ6-sulfanyl)phenyl]propan-2-amine is sourced from PubChem (CID 23643874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).