C16H15FN2 — CID 43179320
3-fluoro-4-[(1-phenylethylamino)methyl]benzonitrile (PubChem CID 43179320) has the molecular formula C16H15FN2 and a molecular weight of 254.31 g/mol. Its IUPAC name is 3-fluoro-4-[(1-phenylethylamino)methyl]benzonitrile.
| Compound Name | 3-fluoro-4-[(1-phenylethylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 43179320 |
| Molecular Formula | C16H15FN2 |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-fluoro-4-[(1-phenylethylamino)methyl]benzonitrile |
| SMILES | CC(NCc1ccc(C#N)cc1F)c1ccccc1 |
| InChI | InChI=1S/C16H15FN2/c1-12(14-5-3-2-4-6-14)19-11-15-8-7-13(10-18)9-16(15)17/h2-9,12,19H,11H2,1H3 |
| InChIKey | WOFIGENFTWVLKE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |