C17H17FN2OS — CID 97231659
3-fluoro-4-[[[(1S)-1-[4-[(S)-methylsulfinyl]phenyl]ethyl]amino]methyl]benzonitrile (PubChem CID 97231659) has the molecular formula C17H17FN2OS and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-fluoro-4-[[[(1S)-1-[4-[(S)-methylsulfinyl]phenyl]ethyl]amino]methyl]benzonitrile.
| Compound Name | 3-fluoro-4-[[[(1S)-1-[4-[(S)-methylsulfinyl]phenyl]ethyl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 97231659 |
| Molecular Formula | C17H17FN2OS |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 3-fluoro-4-[[[(1S)-1-[4-[(S)-methylsulfinyl]phenyl]ethyl]amino]methyl]benzonitrile |
| SMILES | C[C@H](NCc1ccc(C#N)cc1F)c1ccc([S@](C)=O)cc1 |
| InChI | InChI=1S/C17H17FN2OS/c1-12(14-5-7-16(8-6-14)22(2)21)20-11-15-4-3-13(10-19)9-17(15)18/h3-9,12,20H,11H2,1-2H3/t12-,22-/m0/s1 |
| InChIKey | OQTVSXZPNANJPU-YTEVENLXSA-N |
| XLogP | 3.29 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |