C16H25NO4 — CID 43184510
1-(3,4-dimethoxyphenyl)-2-(oxan-2-ylmethoxy)ethanamine (PubChem CID 43184510) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-(oxan-2-ylmethoxy)ethanamine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-(oxan-2-ylmethoxy)ethanamine |
|---|---|
| PubChem CID | 43184510 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-(oxan-2-ylmethoxy)ethanamine |
| SMILES | COc1ccc(C(N)COCC2CCCCO2)cc1OC |
| InChI | InChI=1S/C16H25NO4/c1-18-15-7-6-12(9-16(15)19-2)14(17)11-20-10-13-5-3-4-8-21-13/h6-7,9,13-14H,3-5,8,10-11,17H2,1-2H3 |
| InChIKey | AZMICPYWEYAUHI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |