C17H20N6O3S — CID 4318582
2-methyl-5-[(4-methylpiperazin-1-yl)-(4-nitrophenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol (PubChem CID 4318582) has the molecular formula C17H20N6O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is 2-methyl-5-[(4-methylpiperazin-1-yl)-(4-nitrophenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol.
| Compound Name | 2-methyl-5-[(4-methylpiperazin-1-yl)-(4-nitrophenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
|---|---|
| PubChem CID | 4318582 |
| Molecular Formula | C17H20N6O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-methyl-5-[(4-methylpiperazin-1-yl)-(4-nitrophenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
| SMILES | Cc1nc2sc(C(c3ccc([N+](=O)[O-])cc3)N3CCN(C)CC3)c(O)n2n1 |
| InChI | InChI=1S/C17H20N6O3S/c1-11-18-17-22(19-11)16(24)15(27-17)14(21-9-7-20(2)8-10-21)12-3-5-13(6-4-12)23(25)26/h3-6,14,24H,7-10H2,1-2H3 |
| InChIKey | IUJHCYFUQYOIQG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|