C22H22N6O6S — CID 18574962
ethyl 4-[[2-(furan-2-yl)-6-hydroxy-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]-(4-nitrophenyl)methyl]piperazine-1-carboxylate (PubChem CID 18574962) has the molecular formula C22H22N6O6S and a molecular weight of 498.52 g/mol. Its IUPAC name is ethyl 4-[[2-(furan-2-yl)-6-hydroxy-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]-(4-nitrophenyl)methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(furan-2-yl)-6-hydroxy-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]-(4-nitrophenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 18574962 |
| Molecular Formula | C22H22N6O6S |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | ethyl 4-[[2-(furan-2-yl)-6-hydroxy-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]-(4-nitrophenyl)methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(c2ccc([N+](=O)[O-])cc2)c2sc3nc(-c4ccco4)nn3c2O)CC1 |
| InChI | InChI=1S/C22H22N6O6S/c1-2-33-22(30)26-11-9-25(10-12-26)17(14-5-7-15(8-6-14)28(31)32)18-20(29)27-21(35-18)23-19(24-27)16-4-3-13-34-16/h3-8,13,17,29H,2,9-12H2,1H3 |
| InChIKey | GLXDREYUMNMMNU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|