C25H21FN6O4S — CID 30674911
5-[(S)-[4-(2-fluorophenyl)piperazin-1-yl]-(4-nitrophenyl)methyl]-2-(furan-2-yl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol (PubChem CID 30674911) has the molecular formula C25H21FN6O4S and a molecular weight of 520.55 g/mol. Its IUPAC name is 5-[(S)-[4-(2-fluorophenyl)piperazin-1-yl]-(4-nitrophenyl)methyl]-2-(furan-2-yl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol.
| Compound Name | 5-[(S)-[4-(2-fluorophenyl)piperazin-1-yl]-(4-nitrophenyl)methyl]-2-(furan-2-yl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
|---|---|
| PubChem CID | 30674911 |
| Molecular Formula | C25H21FN6O4S |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | 5-[(S)-[4-(2-fluorophenyl)piperazin-1-yl]-(4-nitrophenyl)methyl]-2-(furan-2-yl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
| SMILES | O=[N+]([O-])c1ccc([C@@H](c2sc3nc(-c4ccco4)nn3c2O)N2CCN(c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C25H21FN6O4S/c26-18-4-1-2-5-19(18)29-11-13-30(14-12-29)21(16-7-9-17(10-8-16)32(34)35)22-24(33)31-25(37-22)27-23(28-31)20-6-3-15-36-20/h1-10,15,21,33H,11-14H2/t21-/m0/s1 |
| InChIKey | DXQARLOZXYBOTF-NRFANRHFSA-N |
| XLogP | 4.72 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|