C15H15N3O2 — CID 43186842
5-[amino-(2-methoxyphenyl)methyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 43186842) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 5-[amino-(2-methoxyphenyl)methyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[amino-(2-methoxyphenyl)methyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 43186842 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 5-[amino-(2-methoxyphenyl)methyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | COc1ccccc1C(N)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C15H15N3O2/c1-20-13-5-3-2-4-10(13)14(16)9-6-7-11-12(8-9)18-15(19)17-11/h2-8,14H,16H2,1H3,(H2,17,18,19) |
| InChIKey | RNFOUKPMXRORJL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |