C14H15F2NOS — CID 43204729
1-[2-(difluoromethoxy)phenyl]-N-(thiophen-2-ylmethyl)ethanamine (PubChem CID 43204729) has the molecular formula C14H15F2NOS and a molecular weight of 283.34 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)phenyl]-N-(thiophen-2-ylmethyl)ethanamine.
| Compound Name | 1-[2-(difluoromethoxy)phenyl]-N-(thiophen-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 43204729 |
| Molecular Formula | C14H15F2NOS |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 1-[2-(difluoromethoxy)phenyl]-N-(thiophen-2-ylmethyl)ethanamine |
| SMILES | CC(NCc1cccs1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C14H15F2NOS/c1-10(17-9-11-5-4-8-19-11)12-6-2-3-7-13(12)18-14(15)16/h2-8,10,14,17H,9H2,1H3 |
| InChIKey | RTNGJYBCEDTMQX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |