C7H8N2O4 — CID 43209786
2-(1,2-oxazole-5-carbonylamino)propanoic acid (PubChem CID 43209786) has the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. Its IUPAC name is 2-(1,2-oxazole-5-carbonylamino)propanoic acid.
| Compound Name | 2-(1,2-oxazole-5-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 43209786 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 2-(1,2-oxazole-5-carbonylamino)propanoic acid |
| SMILES | CC(NC(=O)c1ccno1)C(=O)O |
| InChI | InChI=1S/C7H8N2O4/c1-4(7(11)12)9-6(10)5-2-3-8-13-5/h2-4H,1H3,(H,9,10)(H,11,12) |
| InChIKey | SBRWLNGQTVTCBQ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |