C14H16O3 — CID 43211333
3-(3-ethyl-1-benzofuran-2-yl)butanoic acid (PubChem CID 43211333) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-(3-ethyl-1-benzofuran-2-yl)butanoic acid.
| Compound Name | 3-(3-ethyl-1-benzofuran-2-yl)butanoic acid |
|---|---|
| PubChem CID | 43211333 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 3-(3-ethyl-1-benzofuran-2-yl)butanoic acid |
| SMILES | CCc1c(C(C)CC(=O)O)oc2ccccc12 |
| InChI | InChI=1S/C14H16O3/c1-3-10-11-6-4-5-7-12(11)17-14(10)9(2)8-13(15)16/h4-7,9H,3,8H2,1-2H3,(H,15,16) |
| InChIKey | HYBHPVWLWAFDEL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |