C13H17NO2 — CID 64812611
3-amino-3-(3-ethyl-1-benzofuran-2-yl)propan-1-ol (PubChem CID 64812611) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-amino-3-(3-ethyl-1-benzofuran-2-yl)propan-1-ol.
| Compound Name | 3-amino-3-(3-ethyl-1-benzofuran-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 64812611 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-amino-3-(3-ethyl-1-benzofuran-2-yl)propan-1-ol |
| SMILES | CCc1c(C(N)CCO)oc2ccccc12 |
| InChI | InChI=1S/C13H17NO2/c1-2-9-10-5-3-4-6-12(10)16-13(9)11(14)7-8-15/h3-6,11,15H,2,7-8,14H2,1H3 |
| InChIKey | QYJZEUIFCQTKOB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |