C15H21N3O3 — CID 43212276
3-[2-amino-2-(4-propan-2-yloxyphenyl)ethyl]-1-methylimidazolidine-2,4-dione (PubChem CID 43212276) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-[2-amino-2-(4-propan-2-yloxyphenyl)ethyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[2-amino-2-(4-propan-2-yloxyphenyl)ethyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43212276 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3-[2-amino-2-(4-propan-2-yloxyphenyl)ethyl]-1-methylimidazolidine-2,4-dione |
| SMILES | CC(C)Oc1ccc(C(N)CN2C(=O)CN(C)C2=O)cc1 |
| InChI | InChI=1S/C15H21N3O3/c1-10(2)21-12-6-4-11(5-7-12)13(16)8-18-14(19)9-17(3)15(18)20/h4-7,10,13H,8-9,16H2,1-3H3 |
| InChIKey | QQBHVRUYDRRIJZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|