C13H17N3O3 — CID 43212262
3-[2-amino-2-(2-methoxyphenyl)ethyl]-1-methylimidazolidine-2,4-dione (PubChem CID 43212262) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 3-[2-amino-2-(2-methoxyphenyl)ethyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[2-amino-2-(2-methoxyphenyl)ethyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43212262 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 3-[2-amino-2-(2-methoxyphenyl)ethyl]-1-methylimidazolidine-2,4-dione |
| SMILES | COc1ccccc1C(N)CN1C(=O)CN(C)C1=O |
| InChI | InChI=1S/C13H17N3O3/c1-15-8-12(17)16(13(15)18)7-10(14)9-5-3-4-6-11(9)19-2/h3-6,10H,7-8,14H2,1-2H3 |
| InChIKey | YFCGFCZUUMTKGO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|