C13H17N3O3 — CID 16790120
3-[2-amino-2-(2-ethoxyphenyl)ethyl]imidazolidine-2,4-dione (PubChem CID 16790120) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 3-[2-amino-2-(2-ethoxyphenyl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-amino-2-(2-ethoxyphenyl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 16790120 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 3-[2-amino-2-(2-ethoxyphenyl)ethyl]imidazolidine-2,4-dione |
| SMILES | CCOc1ccccc1C(N)CN1C(=O)CNC1=O |
| InChI | InChI=1S/C13H17N3O3/c1-2-19-11-6-4-3-5-9(11)10(14)8-16-12(17)7-15-13(16)18/h3-6,10H,2,7-8,14H2,1H3,(H,15,18) |
| InChIKey | OAPPUDKMCQNASC-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|