C13H17N3O4 — CID 16794300
3-[2-amino-2-(2,5-dimethoxyphenyl)ethyl]imidazolidine-2,4-dione (PubChem CID 16794300) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 3-[2-amino-2-(2,5-dimethoxyphenyl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-amino-2-(2,5-dimethoxyphenyl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 16794300 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 3-[2-amino-2-(2,5-dimethoxyphenyl)ethyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(OC)c(C(N)CN2C(=O)CNC2=O)c1 |
| InChI | InChI=1S/C13H17N3O4/c1-19-8-3-4-11(20-2)9(5-8)10(14)7-16-12(17)6-15-13(16)18/h3-5,10H,6-7,14H2,1-2H3,(H,15,18) |
| InChIKey | QOSKHFRDGHYKEK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|