C12H13ClN2O3 — CID 95156461
3-[(2S)-2-(2-chlorophenyl)-2-hydroxyethyl]-1-methylimidazolidine-2,4-dione (PubChem CID 95156461) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is 3-[(2S)-2-(2-chlorophenyl)-2-hydroxyethyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(2S)-2-(2-chlorophenyl)-2-hydroxyethyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95156461 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 3-[(2S)-2-(2-chlorophenyl)-2-hydroxyethyl]-1-methylimidazolidine-2,4-dione |
| SMILES | CN1CC(=O)N(C[C@@H](O)c2ccccc2Cl)C1=O |
| InChI | InChI=1S/C12H13ClN2O3/c1-14-7-11(17)15(12(14)18)6-10(16)8-4-2-3-5-9(8)13/h2-5,10,16H,6-7H2,1H3/t10-/m1/s1 |
| InChIKey | ZNHVJUYWJYDKMC-SNVBAGLBSA-N |
| XLogP | 1.27 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|