About N-[2-(2,4-dichlorophenyl)ethyl]-5-methyl-1,3-benzothiazol-2-amine
N-[2-(2,4-dichlorophenyl)ethyl]-5-methyl-1,3-benzothiazol-2-amine (PubChem CID 43213712) has the molecular formula C16H14Cl2N2S
and a molecular weight of 337.28 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-5-methyl-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-5-methyl-1,3-benzothiazol-2-amine |
| PubChem CID | 43213712 |
| Molecular Formula | C16H14Cl2N2S |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-5-methyl-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccc2sc(NCCc3ccc(Cl)cc3Cl)nc2c1 |
| InChI | InChI=1S/C16H14Cl2N2S/c1-10-2-5-15-14(8-10)20-16(21-15)19-7-6-11-3-4-12(17)9-13(11)18/h2-5,8-9H,6-7H2,1H3,(H,19,20) |
| InChIKey | AFKWBYCVBVBVLW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(2,4-dichlorophenyl)ethyl]-5-methyl-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,4-dichlorophenyl)ethyl]-5-methyl-1,3-benzothiazol-2-amine?
The IUPAC name of N-[2-(2,4-dichlorophenyl)ethyl]-5-methyl-1,3-benzothiazol-2-amine (CID 43213712) is N-[2-(2,4-dichlorophenyl)ethyl]-5-methyl-1,3-benzothiazol-2-amine.
What is the SMILES notation for N-[2-(2,4-dichlorophenyl)ethyl]-5-methyl-1,3-benzothiazol-2-amine?
The canonical SMILES for N-[2-(2,4-dichlorophenyl)ethyl]-5-methyl-1,3-benzothiazol-2-amine is Cc1ccc2sc(NCCc3ccc(Cl)cc3Cl)nc2c1.
What is the InChIKey of N-[2-(2,4-dichlorophenyl)ethyl]-5-methyl-1,3-benzothiazol-2-amine?
The InChIKey is AFKWBYCVBVBVLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2N2S/c1-10-2-5-15-14(8-10)20-16(21-15)19-7-6-11-3-4-12(17)9-13(11)18/h2-5,8-9H,6-7H2,1H3,(H,19,20).
What are the key properties of N-[2-(2,4-dichlorophenyl)ethyl]-5-methyl-1,3-benzothiazol-2-amine?
N-[2-(2,4-dichlorophenyl)ethyl]-5-methyl-1,3-benzothiazol-2-amine has a molecular weight of 337.28 g/mol, XLogP of 5.57, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,4-dichlorophenyl)ethyl]-5-methyl-1,3-benzothiazol-2-amine is sourced from PubChem (CID 43213712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).