C12H17FN2O — CID 43214641
2-[1-(4-fluorophenyl)ethylamino]-N,N-dimethylacetamide (PubChem CID 43214641) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)ethylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[1-(4-fluorophenyl)ethylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 43214641 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-[1-(4-fluorophenyl)ethylamino]-N,N-dimethylacetamide |
| SMILES | CC(NCC(=O)N(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H17FN2O/c1-9(14-8-12(16)15(2)3)10-4-6-11(13)7-5-10/h4-7,9,14H,8H2,1-3H3 |
| InChIKey | RHEKPPKLTICVGS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |