C12H16Cl2N2O — CID 43214674
2-[1-(3,4-dichlorophenyl)ethylamino]-N,N-dimethylacetamide (PubChem CID 43214674) has the molecular formula C12H16Cl2N2O and a molecular weight of 275.18 g/mol. Its IUPAC name is 2-[1-(3,4-dichlorophenyl)ethylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[1-(3,4-dichlorophenyl)ethylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 43214674 |
| Molecular Formula | C12H16Cl2N2O |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-[1-(3,4-dichlorophenyl)ethylamino]-N,N-dimethylacetamide |
| SMILES | CC(NCC(=O)N(C)C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2N2O/c1-8(15-7-12(17)16(2)3)9-4-5-10(13)11(14)6-9/h4-6,8,15H,7H2,1-3H3 |
| InChIKey | MOUXNZBEYODGGT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |