C17H15NO3 — CID 43217225
3-[(2-prop-2-ynoxyphenyl)methylamino]benzoic acid (PubChem CID 43217225) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-[(2-prop-2-ynoxyphenyl)methylamino]benzoic acid.
| Compound Name | 3-[(2-prop-2-ynoxyphenyl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 43217225 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 3-[(2-prop-2-ynoxyphenyl)methylamino]benzoic acid |
| SMILES | C#CCOc1ccccc1CNc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H15NO3/c1-2-10-21-16-9-4-3-6-14(16)12-18-15-8-5-7-13(11-15)17(19)20/h1,3-9,11,18H,10,12H2,(H,19,20) |
| InChIKey | ZLCDAMZXELPEIO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|