C15H21NO3 — CID 107864893
2-ethyl-2-[(2-prop-2-ynoxyphenyl)methylamino]propane-1,3-diol (PubChem CID 107864893) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-ethyl-2-[(2-prop-2-ynoxyphenyl)methylamino]propane-1,3-diol.
| Compound Name | 2-ethyl-2-[(2-prop-2-ynoxyphenyl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 107864893 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-ethyl-2-[(2-prop-2-ynoxyphenyl)methylamino]propane-1,3-diol |
| SMILES | C#CCOc1ccccc1CNC(CC)(CO)CO |
| InChI | InChI=1S/C15H21NO3/c1-3-9-19-14-8-6-5-7-13(14)10-16-15(4-2,11-17)12-18/h1,5-8,16-18H,4,9-12H2,2H3 |
| InChIKey | ZQNHBXHHAZELSW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|