C18H27NO — CID 43220796
N-[(2-prop-2-ynoxyphenyl)methyl]octan-2-amine (PubChem CID 43220796) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is N-[(2-prop-2-ynoxyphenyl)methyl]octan-2-amine.
| Compound Name | N-[(2-prop-2-ynoxyphenyl)methyl]octan-2-amine |
|---|---|
| PubChem CID | 43220796 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | N-[(2-prop-2-ynoxyphenyl)methyl]octan-2-amine |
| SMILES | C#CCOc1ccccc1CNC(C)CCCCCC |
| InChI | InChI=1S/C18H27NO/c1-4-6-7-8-11-16(3)19-15-17-12-9-10-13-18(17)20-14-5-2/h2,9-10,12-13,16,19H,4,6-8,11,14-15H2,1,3H3 |
| InChIKey | PFRYJVYGIYBDQU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|