C18H24FN — CID 43223965
N-[1-(2-fluorophenyl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 43223965) has the molecular formula C18H24FN and a molecular weight of 273.39 g/mol. Its IUPAC name is N-[1-(2-fluorophenyl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | N-[1-(2-fluorophenyl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 43223965 |
| Molecular Formula | C18H24FN |
| Molecular Weight | 273.39 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | N-[1-(2-fluorophenyl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | CC(NC1CC2CC1C1CCCC21)c1ccccc1F |
| InChI | InChI=1S/C18H24FN/c1-11(13-5-2-3-8-17(13)19)20-18-10-12-9-16(18)15-7-4-6-14(12)15/h2-3,5,8,11-12,14-16,18,20H,4,6-7,9-10H2,1H3 |
| InChIKey | KTJPKUSPHKTGPM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |