C17H24N2 — CID 81407323
N-[(1R)-1-pyridin-3-ylethyl]tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 81407323) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is N-[(1R)-1-pyridin-3-ylethyl]tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | N-[(1R)-1-pyridin-3-ylethyl]tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 81407323 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | N-[(1R)-1-pyridin-3-ylethyl]tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | C[C@@H](NC1CC2CC1C1CCCC21)c1cccnc1 |
| InChI | InChI=1S/C17H24N2/c1-11(12-4-3-7-18-10-12)19-17-9-13-8-16(17)15-6-2-5-14(13)15/h3-4,7,10-11,13-17,19H,2,5-6,8-9H2,1H3/t11-,13?,14?,15?,16?,17?/m1/s1 |
| InChIKey | VYWFFSRBGMVNIG-IVTVCXSGSA-N |
| XLogP | 3.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |