C15H18ClNS — CID 43230074
4-butan-2-yl-N-[(5-chlorothiophen-2-yl)methyl]aniline (PubChem CID 43230074) has the molecular formula C15H18ClNS and a molecular weight of 279.84 g/mol. Its IUPAC name is 4-butan-2-yl-N-[(5-chlorothiophen-2-yl)methyl]aniline.
| Compound Name | 4-butan-2-yl-N-[(5-chlorothiophen-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 43230074 |
| Molecular Formula | C15H18ClNS |
| Molecular Weight | 279.84 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-butan-2-yl-N-[(5-chlorothiophen-2-yl)methyl]aniline |
| SMILES | CCC(C)c1ccc(NCc2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C15H18ClNS/c1-3-11(2)12-4-6-13(7-5-12)17-10-14-8-9-15(16)18-14/h4-9,11,17H,3,10H2,1-2H3 |
| InChIKey | BBNFLAQLUFOSQN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.84 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |