C17H16Cl3N — CID 43234580
N-[(2,3,6-trichlorophenyl)methyl]-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 43234580) has the molecular formula C17H16Cl3N and a molecular weight of 340.68 g/mol. Its IUPAC name is N-[(2,3,6-trichlorophenyl)methyl]-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | N-[(2,3,6-trichlorophenyl)methyl]-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 43234580 |
| Molecular Formula | C17H16Cl3N |
| Molecular Weight | 340.68 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | N-[(2,3,6-trichlorophenyl)methyl]-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | Clc1ccc(Cl)c(CNC2CCCc3ccccc32)c1Cl |
| InChI | InChI=1S/C17H16Cl3N/c18-14-8-9-15(19)17(20)13(14)10-21-16-7-3-5-11-4-1-2-6-12(11)16/h1-2,4,6,8-9,16,21H,3,5,7,10H2 |
| InChIKey | QFYKKKWPCXHQFU-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.68 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|