C15H20FNO3S — CID 43238435
6-[3-(4-fluorophenyl)sulfanylpropanoylamino]hexanoic acid (PubChem CID 43238435) has the molecular formula C15H20FNO3S and a molecular weight of 313.39 g/mol. Its IUPAC name is 6-[3-(4-fluorophenyl)sulfanylpropanoylamino]hexanoic acid.
| Compound Name | 6-[3-(4-fluorophenyl)sulfanylpropanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 43238435 |
| Molecular Formula | C15H20FNO3S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 6-[3-(4-fluorophenyl)sulfanylpropanoylamino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CCSc1ccc(F)cc1 |
| InChI | InChI=1S/C15H20FNO3S/c16-12-5-7-13(8-6-12)21-11-9-14(18)17-10-3-1-2-4-15(19)20/h5-8H,1-4,9-11H2,(H,17,18)(H,19,20) |
| InChIKey | YKTNCBIQQKQGEJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|