C11H12Cl2N2O3 — CID 43240294
4-[(5,6-dichloropyridine-3-carbonyl)-methylamino]butanoic acid (PubChem CID 43240294) has the molecular formula C11H12Cl2N2O3 and a molecular weight of 291.13 g/mol. Its IUPAC name is 4-[(5,6-dichloropyridine-3-carbonyl)-methylamino]butanoic acid.
| Compound Name | 4-[(5,6-dichloropyridine-3-carbonyl)-methylamino]butanoic acid |
|---|---|
| PubChem CID | 43240294 |
| Molecular Formula | C11H12Cl2N2O3 |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 4-[(5,6-dichloropyridine-3-carbonyl)-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2N2O3/c1-15(4-2-3-9(16)17)11(18)7-5-8(12)10(13)14-6-7/h5-6H,2-4H2,1H3,(H,16,17) |
| InChIKey | WAMRRLPJTWRMIW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|