C12H14FNO3S — CID 43240732
3-[[2-(4-fluorophenyl)sulfanylacetyl]amino]butanoic acid (PubChem CID 43240732) has the molecular formula C12H14FNO3S and a molecular weight of 271.31 g/mol. Its IUPAC name is 3-[[2-(4-fluorophenyl)sulfanylacetyl]amino]butanoic acid.
| Compound Name | 3-[[2-(4-fluorophenyl)sulfanylacetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43240732 |
| Molecular Formula | C12H14FNO3S |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 3-[[2-(4-fluorophenyl)sulfanylacetyl]amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)CSc1ccc(F)cc1 |
| InChI | InChI=1S/C12H14FNO3S/c1-8(6-12(16)17)14-11(15)7-18-10-4-2-9(13)3-5-10/h2-5,8H,6-7H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | ZEVIVTFXBUHBOP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |