C14H19FN2O2S — CID 8733653
(2R)-2-[[2-(4-fluorophenyl)sulfanylacetyl]amino]-N-propylpropanamide (PubChem CID 8733653) has the molecular formula C14H19FN2O2S and a molecular weight of 298.38 g/mol. Its IUPAC name is (2R)-2-[[2-(4-fluorophenyl)sulfanylacetyl]amino]-N-propylpropanamide.
| Compound Name | (2R)-2-[[2-(4-fluorophenyl)sulfanylacetyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 8733653 |
| Molecular Formula | C14H19FN2O2S |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (2R)-2-[[2-(4-fluorophenyl)sulfanylacetyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)[C@@H](C)NC(=O)CSc1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN2O2S/c1-3-8-16-14(19)10(2)17-13(18)9-20-12-6-4-11(15)5-7-12/h4-7,10H,3,8-9H2,1-2H3,(H,16,19)(H,17,18)/t10-/m1/s1 |
| InChIKey | WXHSGARAMAVCOH-SNVBAGLBSA-N |
| XLogP | 1.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |