C12H11FN2O3S — CID 43241511
3-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]propanoic acid (PubChem CID 43241511) has the molecular formula C12H11FN2O3S and a molecular weight of 282.30 g/mol. Its IUPAC name is 3-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 43241511 |
| Molecular Formula | C12H11FN2O3S |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 3-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCc1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C12H11FN2O3S/c13-9-3-1-8(2-4-9)12-14-10(18-15-12)7-19-6-5-11(16)17/h1-4H,5-7H2,(H,16,17) |
| InChIKey | XSUOINYZOSIGSZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|