C14H11NO4 — CID 43244453
3-[[4-(cyanomethyl)phenoxy]methyl]furan-2-carboxylic acid (PubChem CID 43244453) has the molecular formula C14H11NO4 and a molecular weight of 257.25 g/mol. Its IUPAC name is 3-[[4-(cyanomethyl)phenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 3-[[4-(cyanomethyl)phenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 43244453 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 3-[[4-(cyanomethyl)phenoxy]methyl]furan-2-carboxylic acid |
| SMILES | N#CCc1ccc(OCc2ccoc2C(=O)O)cc1 |
| InChI | InChI=1S/C14H11NO4/c15-7-5-10-1-3-12(4-2-10)19-9-11-6-8-18-13(11)14(16)17/h1-4,6,8H,5,9H2,(H,16,17) |
| InChIKey | IHBUIMHKKQXSNG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 83.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |