C12H8F2O4 — CID 43345521
3-[(3,4-difluorophenoxy)methyl]furan-2-carboxylic acid (PubChem CID 43345521) has the molecular formula C12H8F2O4 and a molecular weight of 254.19 g/mol. Its IUPAC name is 3-[(3,4-difluorophenoxy)methyl]furan-2-carboxylic acid.
| Compound Name | 3-[(3,4-difluorophenoxy)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 43345521 |
| Molecular Formula | C12H8F2O4 |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 3-[(3,4-difluorophenoxy)methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1occc1COc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H8F2O4/c13-9-2-1-8(5-10(9)14)18-6-7-3-4-17-11(7)12(15)16/h1-5H,6H2,(H,15,16) |
| InChIKey | PZJDJVRAVCQVDA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |