C11H17N3O5S2 — CID 43245083
2-[(5-carbamoyl-1-methylpyrrol-3-yl)sulfonylamino]-4-methylsulfanylbutanoic acid (PubChem CID 43245083) has the molecular formula C11H17N3O5S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-[(5-carbamoyl-1-methylpyrrol-3-yl)sulfonylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(5-carbamoyl-1-methylpyrrol-3-yl)sulfonylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 43245083 |
| Molecular Formula | C11H17N3O5S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-[(5-carbamoyl-1-methylpyrrol-3-yl)sulfonylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NS(=O)(=O)c1cc(C(N)=O)n(C)c1)C(=O)O |
| InChI | InChI=1S/C11H17N3O5S2/c1-14-6-7(5-9(14)10(12)15)21(18,19)13-8(11(16)17)3-4-20-2/h5-6,8,13H,3-4H2,1-2H3,(H2,12,15)(H,16,17) |
| InChIKey | GOERIIDCOAXOGT-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |