C9H11N3OS2 — CID 43249554
2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methylsulfanyl]ethanamine (PubChem CID 43249554) has the molecular formula C9H11N3OS2 and a molecular weight of 241.34 g/mol. Its IUPAC name is 2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methylsulfanyl]ethanamine.
| Compound Name | 2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methylsulfanyl]ethanamine |
|---|---|
| PubChem CID | 43249554 |
| Molecular Formula | C9H11N3OS2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methylsulfanyl]ethanamine |
| SMILES | NCCSCc1nc(-c2ccsc2)no1 |
| InChI | InChI=1S/C9H11N3OS2/c10-2-4-15-6-8-11-9(12-13-8)7-1-3-14-5-7/h1,3,5H,2,4,6,10H2 |
| InChIKey | NLMBKBMZIAJHLU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|