C9H10N6OS2 — CID 83083192
(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 83083192) has the molecular formula C9H10N6OS2 and a molecular weight of 282.35 g/mol. Its IUPAC name is (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl N-(diaminomethylidene)carbamimidothioate.
| Compound Name | (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83083192 |
| Molecular Formula | C9H10N6OS2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | (3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCc1nc(-c2ccsc2)no1 |
| InChI | InChI=1S/C9H10N6OS2/c10-8(11)14-9(12)18-4-6-13-7(15-16-6)5-1-2-17-3-5/h1-3H,4H2,(H5,10,11,12,14) |
| InChIKey | UTUUOUJEGIGHMC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|