C9H10BrN3OS2 — CID 43249576
2-[[5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]ethanamine (PubChem CID 43249576) has the molecular formula C9H10BrN3OS2 and a molecular weight of 320.24 g/mol. Its IUPAC name is 2-[[5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]ethanamine.
| Compound Name | 2-[[5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]ethanamine |
|---|---|
| PubChem CID | 43249576 |
| Molecular Formula | C9H10BrN3OS2 |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 318.94 |
| IUPAC Name | 2-[[5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]ethanamine |
| SMILES | NCCSCc1nnc(-c2ccc(Br)s2)o1 |
| InChI | InChI=1S/C9H10BrN3OS2/c10-7-2-1-6(16-7)9-13-12-8(14-9)5-15-4-3-11/h1-2H,3-5,11H2 |
| InChIKey | FVDVODLFWJZMFL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|