About [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxybenzoate
[5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxybenzoate (PubChem CID 9197367) has the molecular formula C16H13BrN2O4S
and a molecular weight of 409.26 g/mol. Its IUPAC name is [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxybenzoate.
Molecular Properties
| Compound Name | [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxybenzoate |
| PubChem CID | 9197367 |
| Molecular Formula | C16H13BrN2O4S |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCc2nnc(-c3ccc(Br)s3)o2)cc1 |
| InChI | InChI=1S/C16H13BrN2O4S/c1-2-21-11-5-3-10(4-6-11)16(20)22-9-14-18-19-15(23-14)12-7-8-13(17)24-12/h3-8H,2,9H2,1H3 |
| InChIKey | NFYJPHJRAKEUGX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxybenzoate?
The IUPAC name of [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxybenzoate (CID 9197367) is [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxybenzoate.
What is the SMILES notation for [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxybenzoate?
The canonical SMILES for [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxybenzoate is CCOc1ccc(C(=O)OCc2nnc(-c3ccc(Br)s3)o2)cc1.
What is the InChIKey of [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxybenzoate?
The InChIKey is NFYJPHJRAKEUGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13BrN2O4S/c1-2-21-11-5-3-10(4-6-11)16(20)22-9-14-18-19-15(23-14)12-7-8-13(17)24-12/h3-8H,2,9H2,1H3.
What are the key properties of [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxybenzoate?
[5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxybenzoate has a molecular weight of 409.26 g/mol, XLogP of 4.32, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxybenzoate is sourced from PubChem (CID 9197367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).