About 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-N-(ethylcarbamoyl)propanamide
2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-N-(ethylcarbamoyl)propanamide (PubChem CID 43252708) has the molecular formula C13H27N5O2
and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-N-(ethylcarbamoyl)propanamide.
Molecular Properties
| Compound Name | 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-N-(ethylcarbamoyl)propanamide |
| PubChem CID | 43252708 |
| Molecular Formula | C13H27N5O2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-N-(ethylcarbamoyl)propanamide |
| SMILES | CCNC(=O)NC(=O)C(C)N1CCCN(CCN)CC1 |
| InChI | InChI=1S/C13H27N5O2/c1-3-15-13(20)16-12(19)11(2)18-7-4-6-17(8-5-14)9-10-18/h11H,3-10,14H2,1-2H3,(H2,15,16,19,20) |
| InChIKey | LLECLIIGJHFNDQ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-N-(ethylcarbamoyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-N-(ethylcarbamoyl)propanamide?
The IUPAC name of 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-N-(ethylcarbamoyl)propanamide (CID 43252708) is 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-N-(ethylcarbamoyl)propanamide.
What is the SMILES notation for 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-N-(ethylcarbamoyl)propanamide?
The canonical SMILES for 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-N-(ethylcarbamoyl)propanamide is CCNC(=O)NC(=O)C(C)N1CCCN(CCN)CC1.
What is the InChIKey of 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-N-(ethylcarbamoyl)propanamide?
The InChIKey is LLECLIIGJHFNDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N5O2/c1-3-15-13(20)16-12(19)11(2)18-7-4-6-17(8-5-14)9-10-18/h11H,3-10,14H2,1-2H3,(H2,15,16,19,20).
What are the key properties of 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-N-(ethylcarbamoyl)propanamide?
2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-N-(ethylcarbamoyl)propanamide has a molecular weight of 285.39 g/mol, XLogP of -0.81, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-N-(ethylcarbamoyl)propanamide is sourced from PubChem (CID 43252708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).