C17H36N6O — CID 151041941
2,4-bis[4-(2-aminoethyl)piperazin-1-yl]pentan-3-one (PubChem CID 151041941) has the molecular formula C17H36N6O and a molecular weight of 340.52 g/mol. Its IUPAC name is 2,4-bis[4-(2-aminoethyl)piperazin-1-yl]pentan-3-one.
| Compound Name | 2,4-bis[4-(2-aminoethyl)piperazin-1-yl]pentan-3-one |
|---|---|
| PubChem CID | 151041941 |
| Molecular Formula | C17H36N6O |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.30 |
| IUPAC Name | 2,4-bis[4-(2-aminoethyl)piperazin-1-yl]pentan-3-one |
| SMILES | CC(C(=O)C(C)N1CCN(CCN)CC1)N1CCN(CCN)CC1 |
| InChI | InChI=1S/C17H36N6O/c1-15(22-11-7-20(5-3-18)8-12-22)17(24)16(2)23-13-9-21(6-4-19)10-14-23/h15-16H,3-14,18-19H2,1-2H3 |
| InChIKey | MCGRXYRFLLVQIQ-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |