C19H40N6O — CID 151842926
(2R,4R)-2,4-bis[4-(2-aminopropyl)piperazin-1-yl]pentan-3-one (PubChem CID 151842926) has the molecular formula C19H40N6O and a molecular weight of 368.57 g/mol. Its IUPAC name is (2R,4R)-2,4-bis[4-(2-aminopropyl)piperazin-1-yl]pentan-3-one.
| Compound Name | (2R,4R)-2,4-bis[4-(2-aminopropyl)piperazin-1-yl]pentan-3-one |
|---|---|
| PubChem CID | 151842926 |
| Molecular Formula | C19H40N6O |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.33 |
| IUPAC Name | (2R,4R)-2,4-bis[4-(2-aminopropyl)piperazin-1-yl]pentan-3-one |
| SMILES | CC(N)CN1CCN([C@H](C)C(=O)[C@@H](C)N2CCN(CC(C)N)CC2)CC1 |
| InChI | InChI=1S/C19H40N6O/c1-15(20)13-22-5-9-24(10-6-22)17(3)19(26)18(4)25-11-7-23(8-12-25)14-16(2)21/h15-18H,5-14,20-21H2,1-4H3/t15?,16?,17-,18-/m1/s1 |
| InChIKey | SHAZZAQPAXWEEH-OPQOLIRYSA-N |
| XLogP | -0.74 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |