C9H18N2O4Pt — CID 88639332
oxalic acid;platinum;1-pyrrolidin-1-ylpropan-2-amine (PubChem CID 88639332) has the molecular formula C9H18N2O4Pt and a molecular weight of 413.33 g/mol. Its IUPAC name is oxalic acid;platinum;1-pyrrolidin-1-ylpropan-2-amine.
| Compound Name | oxalic acid;platinum;1-pyrrolidin-1-ylpropan-2-amine |
|---|---|
| PubChem CID | 88639332 |
| Molecular Formula | C9H18N2O4Pt |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | oxalic acid;platinum;1-pyrrolidin-1-ylpropan-2-amine |
| SMILES | CC(N)CN1CCCC1.O=C(O)C(=O)O.[Pt] |
| InChI | InChI=1S/C7H16N2.C2H2O4.Pt/c1-7(8)6-9-4-2-3-5-9;3-1(4)2(5)6;/h7H,2-6,8H2,1H3;(H,3,4)(H,5,6); |
| InChIKey | MLAUMKAMKXLWSQ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|