C12H8Cl2F2N2O2S — CID 43256202
2-amino-4,6-dichloro-N-(3,4-difluorophenyl)benzenesulfonamide (PubChem CID 43256202) has the molecular formula C12H8Cl2F2N2O2S and a molecular weight of 353.18 g/mol. Its IUPAC name is 2-amino-4,6-dichloro-N-(3,4-difluorophenyl)benzenesulfonamide.
| Compound Name | 2-amino-4,6-dichloro-N-(3,4-difluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43256202 |
| Molecular Formula | C12H8Cl2F2N2O2S |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 2-amino-4,6-dichloro-N-(3,4-difluorophenyl)benzenesulfonamide |
| SMILES | Nc1cc(Cl)cc(Cl)c1S(=O)(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H8Cl2F2N2O2S/c13-6-3-8(14)12(11(17)4-6)21(19,20)18-7-1-2-9(15)10(16)5-7/h1-5,18H,17H2 |
| InChIKey | OFJVDHIICCQTGD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|