C15H17N3O — CID 43261281
6-(cyclopropylmethoxy)-2-N-phenylpyridine-2,5-diamine (PubChem CID 43261281) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 6-(cyclopropylmethoxy)-2-N-phenylpyridine-2,5-diamine.
| Compound Name | 6-(cyclopropylmethoxy)-2-N-phenylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 43261281 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 6-(cyclopropylmethoxy)-2-N-phenylpyridine-2,5-diamine |
| SMILES | Nc1ccc(Nc2ccccc2)nc1OCC1CC1 |
| InChI | InChI=1S/C15H17N3O/c16-13-8-9-14(17-12-4-2-1-3-5-12)18-15(13)19-10-11-6-7-11/h1-5,8-9,11H,6-7,10,16H2,(H,17,18) |
| InChIKey | DMGQPNFSTDZYAY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |